C30H41FO4 — CID 67869309
methyl (Z)-7-[(1S,4R,5S,6S)-4-(4-fluorophenyl)-6-[(1E,3S)-3-hydroxy-4,7-dimethylocta-1,6-dienyl]-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoate (PubChem CID 67869309) has the molecular formula C30H41FO4 and a molecular weight of 484.65 g/mol. Its IUPAC name is methyl (Z)-7-[(1S,4R,5S,6S)-4-(4-fluorophenyl)-6-[(1E,3S)-3-hydroxy-4,7-dimethylocta-1,6-dienyl]-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1S,4R,5S,6S)-4-(4-fluorophenyl)-6-[(1E,3S)-3-hydroxy-4,7-dimethylocta-1,6-dienyl]-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoate |
|---|---|
| PubChem CID | 67869309 |
| Molecular Formula | C30H41FO4 |
| Molecular Weight | 484.65 g/mol |
| Exact Mass | 484.30 |
| IUPAC Name | methyl (Z)-7-[(1S,4R,5S,6S)-4-(4-fluorophenyl)-6-[(1E,3S)-3-hydroxy-4,7-dimethylocta-1,6-dienyl]-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoate |
| SMILES | COC(=O)CCC/C=C\C[C@H]1[C@H](/C=C/[C@@H](O)C(C)CC=C(C)C)[C@@H]2C[C@@]1(c1ccc(F)cc1)CO2 |
| InChI | InChI=1S/C30H41FO4/c1-21(2)11-12-22(3)27(32)18-17-25-26(9-7-5-6-8-10-29(33)34-4)30(19-28(25)35-20-30)23-13-15-24(31)16-14-23/h5,7,11,13-18,22,25-28,32H,6,8-10,12,19-20H2,1-4H3/b7-5-,18-17+/t22?,25-,26-,27+,28-,30-/m0/s1 |
| InChIKey | XZQJYJOEKYHTGM-GFQMACGUSA-N |
| XLogP | 6.30 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.65 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|