C24H40O5 — CID 70606629
methyl (Z)-7-[(1R,2R,3R,5S)-2-[(E)-5-cyclopentyl-3-hydroxy-4-methylpent-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoate (PubChem CID 70606629) has the molecular formula C24H40O5 and a molecular weight of 408.58 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,2R,3R,5S)-2-[(E)-5-cyclopentyl-3-hydroxy-4-methylpent-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1R,2R,3R,5S)-2-[(E)-5-cyclopentyl-3-hydroxy-4-methylpent-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 70606629 |
| Molecular Formula | C24H40O5 |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.29 |
| IUPAC Name | methyl (Z)-7-[(1R,2R,3R,5S)-2-[(E)-5-cyclopentyl-3-hydroxy-4-methylpent-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoate |
| SMILES | COC(=O)CCC/C=C\C[C@@H]1[C@@H](/C=C/C(O)C(C)CC2CCCC2)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C24H40O5/c1-17(15-18-9-7-8-10-18)21(25)14-13-20-19(22(26)16-23(20)27)11-5-3-4-6-12-24(28)29-2/h3,5,13-14,17-23,25-27H,4,6-12,15-16H2,1-2H3/b5-3-,14-13+/t17?,19-,20-,21?,22+,23-/m1/s1 |
| InChIKey | JRBRYEPEGKQFPN-QEBWYTCVSA-N |
| XLogP | 3.77 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|