C21H34F2O4 — CID 54178330
methyl 7-[(1R,2R,3R,5R)-5-fluoro-2-[(3R)-4-fluoro-3-hydroxyoct-1-enyl]-3-hydroxycyclopentyl]hept-5-enoate (PubChem CID 54178330) has the molecular formula C21H34F2O4 and a molecular weight of 388.50 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R,5R)-5-fluoro-2-[(3R)-4-fluoro-3-hydroxyoct-1-enyl]-3-hydroxycyclopentyl]hept-5-enoate.
| Compound Name | methyl 7-[(1R,2R,3R,5R)-5-fluoro-2-[(3R)-4-fluoro-3-hydroxyoct-1-enyl]-3-hydroxycyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 54178330 |
| Molecular Formula | C21H34F2O4 |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | methyl 7-[(1R,2R,3R,5R)-5-fluoro-2-[(3R)-4-fluoro-3-hydroxyoct-1-enyl]-3-hydroxycyclopentyl]hept-5-enoate |
| SMILES | CCCCC(F)[C@H](O)C=C[C@@H]1[C@@H](CC=CCCCC(=O)OC)[C@H](F)C[C@H]1O |
| InChI | InChI=1S/C21H34F2O4/c1-3-4-10-17(22)19(24)13-12-16-15(18(23)14-20(16)25)9-7-5-6-8-11-21(26)27-2/h5,7,12-13,15-20,24-25H,3-4,6,8-11,14H2,1-2H3/t15-,16-,17?,18-,19-,20-/m1/s1 |
| InChIKey | OZZYWOIASFSMHJ-JOAQEEOVSA-N |
| XLogP | 4.06 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|