C22H37FO4 — CID 139626842
methyl (E)-7-[(1R,2R,3R,5R)-5-fluoro-3-hydroxy-2-[(E,3R)-3-hydroxy-4-methyloct-1-enyl]cyclopentyl]hept-2-enoate (PubChem CID 139626842) has the molecular formula C22H37FO4 and a molecular weight of 384.53 g/mol. Its IUPAC name is methyl (E)-7-[(1R,2R,3R,5R)-5-fluoro-3-hydroxy-2-[(E,3R)-3-hydroxy-4-methyloct-1-enyl]cyclopentyl]hept-2-enoate.
| Compound Name | methyl (E)-7-[(1R,2R,3R,5R)-5-fluoro-3-hydroxy-2-[(E,3R)-3-hydroxy-4-methyloct-1-enyl]cyclopentyl]hept-2-enoate |
|---|---|
| PubChem CID | 139626842 |
| Molecular Formula | C22H37FO4 |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | methyl (E)-7-[(1R,2R,3R,5R)-5-fluoro-3-hydroxy-2-[(E,3R)-3-hydroxy-4-methyloct-1-enyl]cyclopentyl]hept-2-enoate |
| SMILES | CCCCC(C)[C@@H](O)/C=C/[C@@H]1[C@@H](CCCC/C=C/C(=O)OC)[C@H](F)C[C@H]1O |
| InChI | InChI=1S/C22H37FO4/c1-4-5-10-16(2)20(24)14-13-18-17(19(23)15-21(18)25)11-8-6-7-9-12-22(26)27-3/h9,12-14,16-21,24-25H,4-8,10-11,15H2,1-3H3/b12-9+,14-13+/t16?,17-,18-,19-,20+,21-/m1/s1 |
| InChIKey | WDLYJFHMOOMBGQ-DIICBZNGSA-N |
| XLogP | 4.35 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|