C25H44O3 — CID 164976587
methyl (E)-7-[(1R,2R,3R,5S)-2-[(E,3S,5S)-3,5-dimethylnon-1-enyl]-5-hydroxy-3-methylcyclopentyl]hept-2-enoate (PubChem CID 164976587) has the molecular formula C25H44O3 and a molecular weight of 392.62 g/mol. Its IUPAC name is methyl (E)-7-[(1R,2R,3R,5S)-2-[(E,3S,5S)-3,5-dimethylnon-1-enyl]-5-hydroxy-3-methylcyclopentyl]hept-2-enoate.
| Compound Name | methyl (E)-7-[(1R,2R,3R,5S)-2-[(E,3S,5S)-3,5-dimethylnon-1-enyl]-5-hydroxy-3-methylcyclopentyl]hept-2-enoate |
|---|---|
| PubChem CID | 164976587 |
| Molecular Formula | C25H44O3 |
| Molecular Weight | 392.62 g/mol |
| Exact Mass | 392.33 |
| IUPAC Name | methyl (E)-7-[(1R,2R,3R,5S)-2-[(E,3S,5S)-3,5-dimethylnon-1-enyl]-5-hydroxy-3-methylcyclopentyl]hept-2-enoate |
| SMILES | CCCC[C@H](C)C[C@H](C)/C=C/[C@@H]1[C@@H](CCCC/C=C/C(=O)OC)[C@@H](O)C[C@H]1C |
| InChI | InChI=1S/C25H44O3/c1-6-7-12-19(2)17-20(3)15-16-22-21(4)18-24(26)23(22)13-10-8-9-11-14-25(27)28-5/h11,14-16,19-24,26H,6-10,12-13,17-18H2,1-5H3/b14-11+,16-15+/t19-,20+,21+,22-,23+,24-/m0/s1 |
| InChIKey | IXFXFAXYUDZNJX-ITEPSXSLSA-N |
| XLogP | 6.32 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.62 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|