C26H44O5 — CID 57115937
methyl 7-[(2R,3R,5S)-2-(10,10-dimethyl-9-oxoundec-1-enyl)-3,5-dihydroxycyclopentyl]hept-2-enoate (PubChem CID 57115937) has the molecular formula C26H44O5 and a molecular weight of 436.63 g/mol. Its IUPAC name is methyl 7-[(2R,3R,5S)-2-(10,10-dimethyl-9-oxoundec-1-enyl)-3,5-dihydroxycyclopentyl]hept-2-enoate.
| Compound Name | methyl 7-[(2R,3R,5S)-2-(10,10-dimethyl-9-oxoundec-1-enyl)-3,5-dihydroxycyclopentyl]hept-2-enoate |
|---|---|
| PubChem CID | 57115937 |
| Molecular Formula | C26H44O5 |
| Molecular Weight | 436.63 g/mol |
| Exact Mass | 436.32 |
| IUPAC Name | methyl 7-[(2R,3R,5S)-2-(10,10-dimethyl-9-oxoundec-1-enyl)-3,5-dihydroxycyclopentyl]hept-2-enoate |
| SMILES | COC(=O)C=CCCCCC1[C@@H](C=CCCCCCCC(=O)C(C)(C)C)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C26H44O5/c1-26(2,3)24(29)17-13-8-6-5-7-11-15-20-21(23(28)19-22(20)27)16-12-9-10-14-18-25(30)31-4/h11,14-15,18,20-23,27-28H,5-10,12-13,16-17,19H2,1-4H3/t20-,21?,22-,23+/m1/s1 |
| InChIKey | ZTKUDNINOQJMCW-GTCWDNOESA-N |
| XLogP | 5.15 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.63 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|