C21H27BrO5 — CID 54569942
methyl 7-[3-[(2-bromophenyl)methoxy]-2-formyl-5-hydroxycyclopentyl]hept-2-enoate (PubChem CID 54569942) has the molecular formula C21H27BrO5 and a molecular weight of 439.35 g/mol. Its IUPAC name is methyl 7-[3-[(2-bromophenyl)methoxy]-2-formyl-5-hydroxycyclopentyl]hept-2-enoate.
| Compound Name | methyl 7-[3-[(2-bromophenyl)methoxy]-2-formyl-5-hydroxycyclopentyl]hept-2-enoate |
|---|---|
| PubChem CID | 54569942 |
| Molecular Formula | C21H27BrO5 |
| Molecular Weight | 439.35 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | methyl 7-[3-[(2-bromophenyl)methoxy]-2-formyl-5-hydroxycyclopentyl]hept-2-enoate |
| SMILES | COC(=O)C=CCCCCC1C(O)CC(OCc2ccccc2Br)C1C=O |
| InChI | InChI=1S/C21H27BrO5/c1-26-21(25)11-5-3-2-4-9-16-17(13-23)20(12-19(16)24)27-14-15-8-6-7-10-18(15)22/h5-8,10-11,13,16-17,19-20,24H,2-4,9,12,14H2,1H3 |
| InChIKey | ZWNPKGJZSCJQIB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.35 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|