C38H55BrFNO5Si — CID 91208214
methyl 7-[(1R,2R,3R,5S)-3-[(2-bromophenyl)methoxy]-5-[tert-butyl(dimethyl)silyl]oxy-2-[4-(2-fluorophenoxy)-3-methyl-3-(methylamino)but-1-enyl]cyclopentyl]hept-5-enoate (PubChem CID 91208214) has the molecular formula C38H55BrFNO5Si and a molecular weight of 732.85 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R,5S)-3-[(2-bromophenyl)methoxy]-5-[tert-butyl(dimethyl)silyl]oxy-2-[4-(2-fluorophenoxy)-3-methyl-3-(methylamino)but-1-enyl]cyclopentyl]hept-5-enoate.
| Compound Name | methyl 7-[(1R,2R,3R,5S)-3-[(2-bromophenyl)methoxy]-5-[tert-butyl(dimethyl)silyl]oxy-2-[4-(2-fluorophenoxy)-3-methyl-3-(methylamino)but-1-enyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 91208214 |
| Molecular Formula | C38H55BrFNO5Si |
| Molecular Weight | 732.85 g/mol |
| Exact Mass | 731.30 |
| IUPAC Name | methyl 7-[(1R,2R,3R,5S)-3-[(2-bromophenyl)methoxy]-5-[tert-butyl(dimethyl)silyl]oxy-2-[4-(2-fluorophenoxy)-3-methyl-3-(methylamino)but-1-enyl]cyclopentyl]hept-5-enoate |
| SMILES | CNC(C)(C=C[C@@H]1[C@@H](CC=CCCCC(=O)OC)[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H]1OCc1ccccc1Br)COc1ccccc1F |
| InChI | InChI=1S/C38H55BrFNO5Si/c1-37(2,3)47(7,8)46-35-25-34(44-26-28-17-13-14-19-31(28)39)30(29(35)18-11-9-10-12-22-36(42)43-6)23-24-38(4,41-5)27-45-33-21-16-15-20-32(33)40/h9,11,13-17,19-21,23-24,29-30,34-35,41H,10,12,18,22,25-27H2,1-8H3/t29-,30-,34-,35+,38?/m1/s1 |
| InChIKey | ATGSATMWRDWMGP-YDWLHFSISA-N |
| XLogP | 9.40 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.85 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|