C35H63NO5Si2 — CID 59910577
methyl 7-[(1R,2R,5S)-2-(4-anilino-4-oxobutyl)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclopentyl]heptanoate (PubChem CID 59910577) has the molecular formula C35H63NO5Si2 and a molecular weight of 634.06 g/mol. Its IUPAC name is methyl 7-[(1R,2R,5S)-2-(4-anilino-4-oxobutyl)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,2R,5S)-2-(4-anilino-4-oxobutyl)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclopentyl]heptanoate |
|---|---|
| PubChem CID | 59910577 |
| Molecular Formula | C35H63NO5Si2 |
| Molecular Weight | 634.06 g/mol |
| Exact Mass | 633.42 |
| IUPAC Name | methyl 7-[(1R,2R,5S)-2-(4-anilino-4-oxobutyl)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclopentyl]heptanoate |
| SMILES | COC(=O)CCCCCC[C@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(O[Si](C)(C)C(C)(C)C)[C@@H]1CCCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C35H63NO5Si2/c1-34(2,3)42(8,9)40-30-26-31(41-43(10,11)35(4,5)6)29(28(30)22-17-12-13-18-25-33(38)39-7)23-19-24-32(37)36-27-20-15-14-16-21-27/h14-16,20-21,28-31H,12-13,17-19,22-26H2,1-11H3,(H,36,37)/t28-,29-,30+,31?/m1/s1 |
| InChIKey | QMMXFBBMGJDZKE-UXKMAMCMSA-N |
| XLogP | 9.73 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.06 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|