C35H63NO5Si2 — CID 59910557
methyl 7-[(1R,2R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(3-hydroxy-4-phenyliminobutyl)cyclopentyl]heptanoate (PubChem CID 59910557) has the molecular formula C35H63NO5Si2 and a molecular weight of 634.06 g/mol. Its IUPAC name is methyl 7-[(1R,2R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(3-hydroxy-4-phenyliminobutyl)cyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,2R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(3-hydroxy-4-phenyliminobutyl)cyclopentyl]heptanoate |
|---|---|
| PubChem CID | 59910557 |
| Molecular Formula | C35H63NO5Si2 |
| Molecular Weight | 634.06 g/mol |
| Exact Mass | 633.42 |
| IUPAC Name | methyl 7-[(1R,2R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(3-hydroxy-4-phenyliminobutyl)cyclopentyl]heptanoate |
| SMILES | COC(=O)CCCCCC[C@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(O[Si](C)(C)C(C)(C)C)[C@@H]1CCC(O)/C=N/c1ccccc1 |
| InChI | InChI=1S/C35H63NO5Si2/c1-34(2,3)42(8,9)40-31-25-32(41-43(10,11)35(4,5)6)30(29(31)21-17-12-13-18-22-33(38)39-7)24-23-28(37)26-36-27-19-15-14-16-20-27/h14-16,19-20,26,28-32,37H,12-13,17-18,21-25H2,1-11H3/b36-26+/t28?,29-,30-,31+,32?/m1/s1 |
| InChIKey | ZOJWBHKSJMOJRL-ZJPCZEJLSA-N |
| XLogP | 9.46 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.06 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|