C26H50O5Si2 — CID 11145509
methyl (Z)-7-[(1S,2R,3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-formylcyclopentyl]hept-5-enoate (PubChem CID 11145509) has the molecular formula C26H50O5Si2 and a molecular weight of 498.85 g/mol. Its IUPAC name is methyl (Z)-7-[(1S,2R,3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-formylcyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1S,2R,3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-formylcyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 11145509 |
| Molecular Formula | C26H50O5Si2 |
| Molecular Weight | 498.85 g/mol |
| Exact Mass | 498.32 |
| IUPAC Name | methyl (Z)-7-[(1S,2R,3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-formylcyclopentyl]hept-5-enoate |
| SMILES | COC(=O)CCC/C=C\C[C@H]1[C@@H](C=O)[C@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H50O5Si2/c1-25(2,3)32(8,9)30-22-18-23(31-33(10,11)26(4,5)6)21(19-27)20(22)16-14-12-13-15-17-24(28)29-7/h12,14,19-23H,13,15-18H2,1-11H3/b14-12-/t20-,21+,22-,23+/m0/s1 |
| InChIKey | NJWMMJMCTNGIHA-ZOTJEGHFSA-N |
| XLogP | 6.89 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.85 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|