C26H50O3Si2 — CID 101166285
(1S,2R,3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[(2Z,5Z)-octa-2,5-dienyl]cyclopentane-1-carbaldehyde (PubChem CID 101166285) has the molecular formula C26H50O3Si2 and a molecular weight of 466.86 g/mol. Its IUPAC name is (1S,2R,3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[(2Z,5Z)-octa-2,5-dienyl]cyclopentane-1-carbaldehyde.
| Compound Name | (1S,2R,3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[(2Z,5Z)-octa-2,5-dienyl]cyclopentane-1-carbaldehyde |
|---|---|
| PubChem CID | 101166285 |
| Molecular Formula | C26H50O3Si2 |
| Molecular Weight | 466.86 g/mol |
| Exact Mass | 466.33 |
| IUPAC Name | (1S,2R,3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[(2Z,5Z)-octa-2,5-dienyl]cyclopentane-1-carbaldehyde |
| SMILES | CC/C=C\C/C=C\C[C@@H]1[C@H](C=O)[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H50O3Si2/c1-12-13-14-15-16-17-18-21-22(20-27)24(29-31(10,11)26(5,6)7)19-23(21)28-30(8,9)25(2,3)4/h13-14,16-17,20-24H,12,15,18-19H2,1-11H3/b14-13-,17-16-/t21-,22+,23-,24+/m1/s1 |
| InChIKey | YVASMVZNFICSKY-DJFRRCJASA-N |
| XLogP | 7.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.86 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|