C27H56O4Si2 — CID 101200510
(E,3S)-1-[(1R,2S,3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(2-hydroxyethyl)cyclopentyl]oct-1-en-3-ol (PubChem CID 101200510) has the molecular formula C27H56O4Si2 and a molecular weight of 500.91 g/mol. Its IUPAC name is (E,3S)-1-[(1R,2S,3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(2-hydroxyethyl)cyclopentyl]oct-1-en-3-ol.
| Compound Name | (E,3S)-1-[(1R,2S,3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(2-hydroxyethyl)cyclopentyl]oct-1-en-3-ol |
|---|---|
| PubChem CID | 101200510 |
| Molecular Formula | C27H56O4Si2 |
| Molecular Weight | 500.91 g/mol |
| Exact Mass | 500.37 |
| IUPAC Name | (E,3S)-1-[(1R,2S,3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(2-hydroxyethyl)cyclopentyl]oct-1-en-3-ol |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H]1[C@H](CCO)[C@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H56O4Si2/c1-12-13-14-15-21(29)16-17-22-23(18-19-28)25(31-33(10,11)27(5,6)7)20-24(22)30-32(8,9)26(2,3)4/h16-17,21-25,28-29H,12-15,18-20H2,1-11H3/b17-16+/t21-,22+,23-,24-,25+/m0/s1 |
| InChIKey | KZRKSBSRTIVQGB-AZLKOYJCSA-N |
| XLogP | 7.28 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.91 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|