C27H50O4Si — CID 57110528
(3S)-1-[(1'S,2'R,3'aR,6'aS)-2'-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-yl]oct-1-en-3-ol (PubChem CID 57110528) has the molecular formula C27H50O4Si and a molecular weight of 466.78 g/mol. Its IUPAC name is (3S)-1-[(1'S,2'R,3'aR,6'aS)-2'-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-yl]oct-1-en-3-ol.
| Compound Name | (3S)-1-[(1'S,2'R,3'aR,6'aS)-2'-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-yl]oct-1-en-3-ol |
|---|---|
| PubChem CID | 57110528 |
| Molecular Formula | C27H50O4Si |
| Molecular Weight | 466.78 g/mol |
| Exact Mass | 466.35 |
| IUPAC Name | (3S)-1-[(1'S,2'R,3'aR,6'aS)-2'-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-yl]oct-1-en-3-ol |
| SMILES | CCCCC[C@H](O)C=C[C@H]1[C@H]2CC3(C[C@H]2C[C@H]1O[Si](C)(C)C(C)(C)C)OCC(C)(C)CO3 |
| InChI | InChI=1S/C27H50O4Si/c1-9-10-11-12-21(28)13-14-22-23-17-27(29-18-26(5,6)19-30-27)16-20(23)15-24(22)31-32(7,8)25(2,3)4/h13-14,20-24,28H,9-12,15-19H2,1-8H3/t20-,21+,22+,23+,24-/m1/s1 |
| InChIKey | CLAOTRJRLSNLPG-LYCSZFELSA-N |
| XLogP | 6.69 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.78 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|