C33H63NO5Si — CID 102034626
tert-butyl (1S,2R,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2-[(E)-3-(2,2,6,6-tetramethylpiperidin-1-yl)oxyoct-1-enyl]cyclopentane-1-carboxylate (PubChem CID 102034626) has the molecular formula C33H63NO5Si and a molecular weight of 581.96 g/mol. Its IUPAC name is tert-butyl (1S,2R,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2-[(E)-3-(2,2,6,6-tetramethylpiperidin-1-yl)oxyoct-1-enyl]cyclopentane-1-carboxylate.
| Compound Name | tert-butyl (1S,2R,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2-[(E)-3-(2,2,6,6-tetramethylpiperidin-1-yl)oxyoct-1-enyl]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 102034626 |
| Molecular Formula | C33H63NO5Si |
| Molecular Weight | 581.96 g/mol |
| Exact Mass | 581.45 |
| IUPAC Name | tert-butyl (1S,2R,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2-[(E)-3-(2,2,6,6-tetramethylpiperidin-1-yl)oxyoct-1-enyl]cyclopentane-1-carboxylate |
| SMILES | CCCCCC(/C=C/[C@@H]1[C@H](C(=O)OC(C)(C)C)[C@@H](O)C[C@H]1O[Si](C)(C)C(C)(C)C)ON1C(C)(C)CCCC1(C)C |
| InChI | InChI=1S/C33H63NO5Si/c1-14-15-16-18-24(38-34-32(8,9)21-17-22-33(34,10)11)19-20-25-27(39-40(12,13)31(5,6)7)23-26(35)28(25)29(36)37-30(2,3)4/h19-20,24-28,35H,14-18,21-23H2,1-13H3/b20-19+/t24?,25-,26-,27+,28-/m0/s1 |
| InChIKey | SZERMEXQNIKBHJ-KINVQNJVSA-N |
| XLogP | 8.20 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.96 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|