C30H59NO6SSi — CID 46855805
[(1R,2R,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2-[(E)-3-(2,2,6,6-tetramethylpiperidin-1-yl)oxyoct-1-enyl]cyclopentyl]methyl methanesulfonate (PubChem CID 46855805) has the molecular formula C30H59NO6SSi and a molecular weight of 589.96 g/mol. Its IUPAC name is [(1R,2R,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2-[(E)-3-(2,2,6,6-tetramethylpiperidin-1-yl)oxyoct-1-enyl]cyclopentyl]methyl methanesulfonate.
| Compound Name | [(1R,2R,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2-[(E)-3-(2,2,6,6-tetramethylpiperidin-1-yl)oxyoct-1-enyl]cyclopentyl]methyl methanesulfonate |
|---|---|
| PubChem CID | 46855805 |
| Molecular Formula | C30H59NO6SSi |
| Molecular Weight | 589.96 g/mol |
| Exact Mass | 589.38 |
| IUPAC Name | [(1R,2R,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2-[(E)-3-(2,2,6,6-tetramethylpiperidin-1-yl)oxyoct-1-enyl]cyclopentyl]methyl methanesulfonate |
| SMILES | CCCCCC(/C=C/[C@@H]1[C@H](COS(C)(=O)=O)[C@@H](O)C[C@H]1O[Si](C)(C)C(C)(C)C)ON1C(C)(C)CCCC1(C)C |
| InChI | InChI=1S/C30H59NO6SSi/c1-12-13-14-16-23(36-31-29(5,6)19-15-20-30(31,7)8)17-18-24-25(22-35-38(9,33)34)26(32)21-27(24)37-39(10,11)28(2,3)4/h17-18,23-27,32H,12-16,19-22H2,1-11H3/b18-17+/t23?,24-,25+,26+,27-/m1/s1 |
| InChIKey | IEDUOUKSCNULHM-MMASTIIDSA-N |
| XLogP | 6.83 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.96 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|