C39H82O6Si4 — CID 11686397
methyl (E,5S)-5-[tert-butyl(dimethyl)silyl]oxy-7-[(1R,2S,3R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-triethylsilyloxy-2-(2-triethylsilyloxyethyl)cyclopentyl]hept-6-enoate (PubChem CID 11686397) has the molecular formula C39H82O6Si4 and a molecular weight of 759.42 g/mol. Its IUPAC name is methyl (E,5S)-5-[tert-butyl(dimethyl)silyl]oxy-7-[(1R,2S,3R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-triethylsilyloxy-2-(2-triethylsilyloxyethyl)cyclopentyl]hept-6-enoate.
| Compound Name | methyl (E,5S)-5-[tert-butyl(dimethyl)silyl]oxy-7-[(1R,2S,3R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-triethylsilyloxy-2-(2-triethylsilyloxyethyl)cyclopentyl]hept-6-enoate |
|---|---|
| PubChem CID | 11686397 |
| Molecular Formula | C39H82O6Si4 |
| Molecular Weight | 759.42 g/mol |
| Exact Mass | 758.52 |
| IUPAC Name | methyl (E,5S)-5-[tert-butyl(dimethyl)silyl]oxy-7-[(1R,2S,3R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-triethylsilyloxy-2-(2-triethylsilyloxyethyl)cyclopentyl]hept-6-enoate |
| SMILES | CC[Si](CC)(CC)OCC[C@H]1[C@@H](/C=C/[C@H](CCCC(=O)OC)O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H]1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C39H82O6Si4/c1-18-48(19-2,20-3)42-30-29-34-33(28-27-32(25-24-26-37(40)41-13)43-46(14,15)38(7,8)9)35(44-47(16,17)39(10,11)12)31-36(34)45-49(21-4,22-5)23-6/h27-28,32-36H,18-26,29-31H2,1-17H3/b28-27+/t32-,33+,34-,35-,36+/m0/s1 |
| InChIKey | UMOOSOTYPYYJMI-RUOOXPHJSA-N |
| XLogP | 12.11 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.42 |
| LogP ≤ 5 | 12.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|