C33H61NO4Si2 — CID 102506064
methyl 5-[(4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(E,3R)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-1,4,5,6-tetrahydrocyclopenta[b]pyrrol-2-yl]pentanoate (PubChem CID 102506064) has the molecular formula C33H61NO4Si2 and a molecular weight of 592.03 g/mol. Its IUPAC name is methyl 5-[(4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(E,3R)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-1,4,5,6-tetrahydrocyclopenta[b]pyrrol-2-yl]pentanoate.
| Compound Name | methyl 5-[(4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(E,3R)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-1,4,5,6-tetrahydrocyclopenta[b]pyrrol-2-yl]pentanoate |
|---|---|
| PubChem CID | 102506064 |
| Molecular Formula | C33H61NO4Si2 |
| Molecular Weight | 592.03 g/mol |
| Exact Mass | 591.41 |
| IUPAC Name | methyl 5-[(4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(E,3R)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-1,4,5,6-tetrahydrocyclopenta[b]pyrrol-2-yl]pentanoate |
| SMILES | CCCCC[C@H](/C=C/[C@@H]1c2cc(CCCCC(=O)OC)[nH]c2C[C@H]1O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H61NO4Si2/c1-13-14-15-19-26(37-39(9,10)32(2,3)4)21-22-27-28-23-25(18-16-17-20-31(35)36-8)34-29(28)24-30(27)38-40(11,12)33(5,6)7/h21-23,26-27,30,34H,13-20,24H2,1-12H3/b22-21+/t26-,27-,30-/m1/s1 |
| InChIKey | CJGRZWSFKVGNQG-RWQFLHMPSA-N |
| XLogP | 9.46 |
| TPSA | 60.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.03 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|