C29H50O4SSi — CID 57183753
methyl 7-[5-[3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-3-ethylsulfanyl-2-oxocyclopent-3-en-1-ylidene]heptanoate (PubChem CID 57183753) has the molecular formula C29H50O4SSi and a molecular weight of 522.87 g/mol. Its IUPAC name is methyl 7-[5-[3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-3-ethylsulfanyl-2-oxocyclopent-3-en-1-ylidene]heptanoate.
| Compound Name | methyl 7-[5-[3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-3-ethylsulfanyl-2-oxocyclopent-3-en-1-ylidene]heptanoate |
|---|---|
| PubChem CID | 57183753 |
| Molecular Formula | C29H50O4SSi |
| Molecular Weight | 522.87 g/mol |
| Exact Mass | 522.32 |
| IUPAC Name | methyl 7-[5-[3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-3-ethylsulfanyl-2-oxocyclopent-3-en-1-ylidene]heptanoate |
| SMILES | CCCCCC(C=CC1C=C(SCC)C(=O)C1=CCCCCCC(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H50O4SSi/c1-9-11-14-17-24(33-35(7,8)29(3,4)5)21-20-23-22-26(34-10-2)28(31)25(23)18-15-12-13-16-19-27(30)32-6/h18,20-24H,9-17,19H2,1-8H3 |
| InChIKey | NPOUKWLBRLFLQV-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.87 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|