C27H48O6Si — CID 57164428
methyl 7-[4-[3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-3-oxo-6-oxabicyclo[3.1.0]hexan-2-yl]-7-hydroxyheptanoate (PubChem CID 57164428) has the molecular formula C27H48O6Si and a molecular weight of 496.76 g/mol. Its IUPAC name is methyl 7-[4-[3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-3-oxo-6-oxabicyclo[3.1.0]hexan-2-yl]-7-hydroxyheptanoate.
| Compound Name | methyl 7-[4-[3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-3-oxo-6-oxabicyclo[3.1.0]hexan-2-yl]-7-hydroxyheptanoate |
|---|---|
| PubChem CID | 57164428 |
| Molecular Formula | C27H48O6Si |
| Molecular Weight | 496.76 g/mol |
| Exact Mass | 496.32 |
| IUPAC Name | methyl 7-[4-[3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-3-oxo-6-oxabicyclo[3.1.0]hexan-2-yl]-7-hydroxyheptanoate |
| SMILES | CCCCCC(C=CC1C(=O)C(C(O)CCCCCC(=O)OC)C2OC12)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H48O6Si/c1-8-9-11-14-19(33-34(6,7)27(2,3)4)17-18-20-24(30)23(26-25(20)32-26)21(28)15-12-10-13-16-22(29)31-5/h17-21,23,25-26,28H,8-16H2,1-7H3 |
| InChIKey | NOFMREOENDBPQP-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.76 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|