C25H44O4Si — CID 56958097
methyl (E,9S)-9-[tert-butyl(dimethyl)silyl]oxy-11-(2-ethyl-3-oxocyclopenten-1-yl)undec-10-enoate (PubChem CID 56958097) has the molecular formula C25H44O4Si and a molecular weight of 436.71 g/mol. Its IUPAC name is methyl (E,9S)-9-[tert-butyl(dimethyl)silyl]oxy-11-(2-ethyl-3-oxocyclopenten-1-yl)undec-10-enoate.
| Compound Name | methyl (E,9S)-9-[tert-butyl(dimethyl)silyl]oxy-11-(2-ethyl-3-oxocyclopenten-1-yl)undec-10-enoate |
|---|---|
| PubChem CID | 56958097 |
| Molecular Formula | C25H44O4Si |
| Molecular Weight | 436.71 g/mol |
| Exact Mass | 436.30 |
| IUPAC Name | methyl (E,9S)-9-[tert-butyl(dimethyl)silyl]oxy-11-(2-ethyl-3-oxocyclopenten-1-yl)undec-10-enoate |
| SMILES | CCC1=C(/C=C/[C@H](CCCCCCCC(=O)OC)O[Si](C)(C)C(C)(C)C)CCC1=O |
| InChI | InChI=1S/C25H44O4Si/c1-8-22-20(17-19-23(22)26)16-18-21(29-30(6,7)25(2,3)4)14-12-10-9-11-13-15-24(27)28-5/h16,18,21H,8-15,17,19H2,1-7H3/b18-16+/t21-/m0/s1 |
| InChIKey | YRVVRCNRAILECF-LAYTVVDLSA-N |
| XLogP | 6.91 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.71 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|