C22H37NO6Si — CID 5379790
methyl (E)-8-[(3Z)-3-methoxyimino-2-(3-methoxy-3-oxopropyl)cyclopenten-1-yl]-6-trimethylsilyloxyoct-7-enoate (PubChem CID 5379790) has the molecular formula C22H37NO6Si and a molecular weight of 439.63 g/mol. Its IUPAC name is methyl (E)-8-[(3Z)-3-methoxyimino-2-(3-methoxy-3-oxopropyl)cyclopenten-1-yl]-6-trimethylsilyloxyoct-7-enoate.
| Compound Name | methyl (E)-8-[(3Z)-3-methoxyimino-2-(3-methoxy-3-oxopropyl)cyclopenten-1-yl]-6-trimethylsilyloxyoct-7-enoate |
|---|---|
| PubChem CID | 5379790 |
| Molecular Formula | C22H37NO6Si |
| Molecular Weight | 439.63 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | methyl (E)-8-[(3Z)-3-methoxyimino-2-(3-methoxy-3-oxopropyl)cyclopenten-1-yl]-6-trimethylsilyloxyoct-7-enoate |
| SMILES | CO/N=C1/CCC(/C=C/C(CCCCC(=O)OC)O[Si](C)(C)C)=C1CCC(=O)OC |
| InChI | InChI=1S/C22H37NO6Si/c1-26-21(24)10-8-7-9-18(29-30(4,5)6)13-11-17-12-15-20(23-28-3)19(17)14-16-22(25)27-2/h11,13,18H,7-10,12,14-16H2,1-6H3/b13-11+,23-20- |
| InChIKey | GOCVWPAKUZHOPC-YHTZLPLQSA-N |
| XLogP | 4.54 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.63 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|