C27H51NO4Si2 — CID 177404290
trimethylsilyl 7-[(5E)-5-methoxyimino-2-[(E,3S)-3-trimethylsilyloxyoct-1-enyl]cyclopenten-1-yl]heptanoate (PubChem CID 177404290) has the molecular formula C27H51NO4Si2 and a molecular weight of 509.88 g/mol. Its IUPAC name is trimethylsilyl 7-[(5E)-5-methoxyimino-2-[(E,3S)-3-trimethylsilyloxyoct-1-enyl]cyclopenten-1-yl]heptanoate.
| Compound Name | trimethylsilyl 7-[(5E)-5-methoxyimino-2-[(E,3S)-3-trimethylsilyloxyoct-1-enyl]cyclopenten-1-yl]heptanoate |
|---|---|
| PubChem CID | 177404290 |
| Molecular Formula | C27H51NO4Si2 |
| Molecular Weight | 509.88 g/mol |
| Exact Mass | 509.34 |
| IUPAC Name | trimethylsilyl 7-[(5E)-5-methoxyimino-2-[(E,3S)-3-trimethylsilyloxyoct-1-enyl]cyclopenten-1-yl]heptanoate |
| SMILES | CCCCC[C@@H](/C=C/C1=C(CCCCCCC(=O)O[Si](C)(C)C)/C(=N/OC)CC1)O[Si](C)(C)C |
| InChI | InChI=1S/C27H51NO4Si2/c1-9-10-13-16-24(31-33(3,4)5)21-19-23-20-22-26(28-30-2)25(23)17-14-11-12-15-18-27(29)32-34(6,7)8/h19,21,24H,9-18,20,22H2,1-8H3/b21-19+,28-26+/t24-/m0/s1 |
| InChIKey | ZGUGYUAUEGQMTR-KAIXDMJNSA-N |
| XLogP | 8.15 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.88 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|