C30H59NO5Si3 — CID 21160097
trimethylsilyl (E)-7-[(1R,2R,5E)-5-methoxyimino-3-trimethylsilyloxy-2-[(E)-3-trimethylsilyloxyoct-1-enyl]cyclopentyl]hept-5-enoate (PubChem CID 21160097) has the molecular formula C30H59NO5Si3 and a molecular weight of 598.06 g/mol. Its IUPAC name is trimethylsilyl (E)-7-[(1R,2R,5E)-5-methoxyimino-3-trimethylsilyloxy-2-[(E)-3-trimethylsilyloxyoct-1-enyl]cyclopentyl]hept-5-enoate.
| Compound Name | trimethylsilyl (E)-7-[(1R,2R,5E)-5-methoxyimino-3-trimethylsilyloxy-2-[(E)-3-trimethylsilyloxyoct-1-enyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 21160097 |
| Molecular Formula | C30H59NO5Si3 |
| Molecular Weight | 598.06 g/mol |
| Exact Mass | 597.37 |
| IUPAC Name | trimethylsilyl (E)-7-[(1R,2R,5E)-5-methoxyimino-3-trimethylsilyloxy-2-[(E)-3-trimethylsilyloxyoct-1-enyl]cyclopentyl]hept-5-enoate |
| SMILES | CCCCCC(/C=C/[C@H]1C(O[Si](C)(C)C)C/C(=N\OC)[C@@H]1C/C=C/CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C30H59NO5Si3/c1-12-13-16-19-25(34-37(3,4)5)22-23-27-26(28(31-33-2)24-29(27)35-38(6,7)8)20-17-14-15-18-21-30(32)36-39(9,10)11/h14,17,22-23,25-27,29H,12-13,15-16,18-21,24H2,1-11H3/b17-14+,23-22+,31-28+/t25?,26-,27-,29?/m1/s1 |
| InChIKey | CAGDKDNXQZFLSL-XBGCNYMFSA-N |
| XLogP | 8.70 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.06 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|