C36H60O5Si2 — CID 46913236
methyl (E)-7-[(1R,2R,3R)-5-oxo-2-[(E,3S)-5-phenyl-3-triethylsilyloxypent-1-enyl]-3-triethylsilyloxycyclopentyl]hept-5-enoate (PubChem CID 46913236) has the molecular formula C36H60O5Si2 and a molecular weight of 629.04 g/mol. Its IUPAC name is methyl (E)-7-[(1R,2R,3R)-5-oxo-2-[(E,3S)-5-phenyl-3-triethylsilyloxypent-1-enyl]-3-triethylsilyloxycyclopentyl]hept-5-enoate.
| Compound Name | methyl (E)-7-[(1R,2R,3R)-5-oxo-2-[(E,3S)-5-phenyl-3-triethylsilyloxypent-1-enyl]-3-triethylsilyloxycyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 46913236 |
| Molecular Formula | C36H60O5Si2 |
| Molecular Weight | 629.04 g/mol |
| Exact Mass | 628.40 |
| IUPAC Name | methyl (E)-7-[(1R,2R,3R)-5-oxo-2-[(E,3S)-5-phenyl-3-triethylsilyloxypent-1-enyl]-3-triethylsilyloxycyclopentyl]hept-5-enoate |
| SMILES | CC[Si](CC)(CC)O[C@H](/C=C/[C@H]1[C@H](O[Si](CC)(CC)CC)CC(=O)[C@@H]1C/C=C/CCCC(=O)OC)CCc1ccccc1 |
| InChI | InChI=1S/C36H60O5Si2/c1-8-42(9-2,10-3)40-31(26-25-30-21-17-16-18-22-30)27-28-33-32(23-19-14-15-20-24-36(38)39-7)34(37)29-35(33)41-43(11-4,12-5)13-6/h14,16-19,21-22,27-28,31-33,35H,8-13,15,20,23-26,29H2,1-7H3/b19-14+,28-27+/t31-,32+,33+,35+/m0/s1 |
| InChIKey | XIQNXAASNMXIOO-SZNMDDKRSA-N |
| XLogP | 9.45 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.04 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|