C41H76O5Si3 — CID 23649139
propan-2-yl (Z)-7-[(1R,2R,3R,5S)-2-[(3R)-5-phenyl-3-triethylsilyloxypentyl]-5-triethylsilyloxy-3-trimethylsilyloxycyclopentyl]hept-5-enoate (PubChem CID 23649139) has the molecular formula C41H76O5Si3 and a molecular weight of 733.31 g/mol. Its IUPAC name is propan-2-yl (Z)-7-[(1R,2R,3R,5S)-2-[(3R)-5-phenyl-3-triethylsilyloxypentyl]-5-triethylsilyloxy-3-trimethylsilyloxycyclopentyl]hept-5-enoate.
| Compound Name | propan-2-yl (Z)-7-[(1R,2R,3R,5S)-2-[(3R)-5-phenyl-3-triethylsilyloxypentyl]-5-triethylsilyloxy-3-trimethylsilyloxycyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 23649139 |
| Molecular Formula | C41H76O5Si3 |
| Molecular Weight | 733.31 g/mol |
| Exact Mass | 732.50 |
| IUPAC Name | propan-2-yl (Z)-7-[(1R,2R,3R,5S)-2-[(3R)-5-phenyl-3-triethylsilyloxypentyl]-5-triethylsilyloxy-3-trimethylsilyloxycyclopentyl]hept-5-enoate |
| SMILES | CC[Si](CC)(CC)O[C@@H](CCc1ccccc1)CC[C@@H]1[C@@H](C/C=C\CCCC(=O)OC(C)C)[C@@H](O[Si](CC)(CC)CC)C[C@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C41H76O5Si3/c1-12-48(13-2,14-3)44-36(30-29-35-25-21-20-22-26-35)31-32-38-37(27-23-18-19-24-28-41(42)43-34(7)8)40(33-39(38)45-47(9,10)11)46-49(15-4,16-5)17-6/h18,20-23,25-26,34,36-40H,12-17,19,24,27-33H2,1-11H3/b23-18-/t36-,37+,38+,39+,40-/m0/s1 |
| InChIKey | IMOBTFWTPMJYMA-YRXQCNAXSA-N |
| XLogP | 12.10 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.31 |
| LogP ≤ 5 | 12.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|