C28H44O6P2 — CID 21031323
propan-2-yl (E)-7-[2-[2-[2-(2-phenylethyl)-1,3-dioxolan-2-yl]ethyl]-3,5-bis(phosphanyloxy)cyclopentyl]hept-5-enoate (PubChem CID 21031323) has the molecular formula C28H44O6P2 and a molecular weight of 538.60 g/mol. Its IUPAC name is propan-2-yl (E)-7-[2-[2-[2-(2-phenylethyl)-1,3-dioxolan-2-yl]ethyl]-3,5-bis(phosphanyloxy)cyclopentyl]hept-5-enoate.
| Compound Name | propan-2-yl (E)-7-[2-[2-[2-(2-phenylethyl)-1,3-dioxolan-2-yl]ethyl]-3,5-bis(phosphanyloxy)cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 21031323 |
| Molecular Formula | C28H44O6P2 |
| Molecular Weight | 538.60 g/mol |
| Exact Mass | 538.26 |
| IUPAC Name | propan-2-yl (E)-7-[2-[2-[2-(2-phenylethyl)-1,3-dioxolan-2-yl]ethyl]-3,5-bis(phosphanyloxy)cyclopentyl]hept-5-enoate |
| SMILES | CC(C)OC(=O)CCC/C=C/CC1C(OP)CC(OP)C1CCC1(CCc2ccccc2)OCCO1 |
| InChI | InChI=1S/C28H44O6P2/c1-21(2)32-27(29)13-9-4-3-8-12-23-24(26(34-36)20-25(23)33-35)15-17-28(30-18-19-31-28)16-14-22-10-6-5-7-11-22/h3,5-8,10-11,21,23-26H,4,9,12-20,35-36H2,1-2H3/b8-3+ |
| InChIKey | XEQAXUVUJMSCRO-FPYGCLRLSA-N |
| XLogP | 6.20 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.60 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|