C25H38O6P2 — CID 58649673
(Z)-7-[(1R,2R,3R,5S)-2-[2-[2-(2-phenylethyl)-1,3-dioxolan-2-yl]ethyl]-3,5-bis(tritiophosphanyloxy)cyclopentyl]hept-5-enoic acid (PubChem CID 58649673) has the molecular formula C25H38O6P2 and a molecular weight of 500.54 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3R,5S)-2-[2-[2-(2-phenylethyl)-1,3-dioxolan-2-yl]ethyl]-3,5-bis(tritiophosphanyloxy)cyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3R,5S)-2-[2-[2-(2-phenylethyl)-1,3-dioxolan-2-yl]ethyl]-3,5-bis(tritiophosphanyloxy)cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 58649673 |
| Molecular Formula | C25H38O6P2 |
| Molecular Weight | 500.54 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | (Z)-7-[(1R,2R,3R,5S)-2-[2-[2-(2-phenylethyl)-1,3-dioxolan-2-yl]ethyl]-3,5-bis(tritiophosphanyloxy)cyclopentyl]hept-5-enoic acid |
| SMILES | [3H]PO[C@H]1C[C@@H](OP[3H])[C@H](CCC2(CCc3ccccc3)OCCO2)[C@H]1C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C25H38O6P2/c26-24(27)11-7-2-1-6-10-20-21(23(31-33)18-22(20)30-32)13-15-25(28-16-17-29-25)14-12-19-8-4-3-5-9-19/h1,3-6,8-9,20-23H,2,7,10-18,32-33H2,(H,26,27)/b6-1-/t20-,21-,22+,23-/m1/s1/i32T,33T/t20-,21-,22+,23-,32?,33? |
| InChIKey | XMKUJHRRUKLIAU-SZMWMKJFSA-N |
| XLogP | 5.33 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.54 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|