C23H41O6P — CID 90862591
7-[(2R)-2-[2-(2-hexan-2-yl-1,3-dioxolan-2-yl)ethyl]-5-hydroxy-3-phosphanyloxycyclopentyl]hept-5-enoic acid (PubChem CID 90862591) has the molecular formula C23H41O6P and a molecular weight of 444.55 g/mol. Its IUPAC name is 7-[(2R)-2-[2-(2-hexan-2-yl-1,3-dioxolan-2-yl)ethyl]-5-hydroxy-3-phosphanyloxycyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(2R)-2-[2-(2-hexan-2-yl-1,3-dioxolan-2-yl)ethyl]-5-hydroxy-3-phosphanyloxycyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 90862591 |
| Molecular Formula | C23H41O6P |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.26 |
| IUPAC Name | 7-[(2R)-2-[2-(2-hexan-2-yl-1,3-dioxolan-2-yl)ethyl]-5-hydroxy-3-phosphanyloxycyclopentyl]hept-5-enoic acid |
| SMILES | CCCCC(C)C1(CC[C@H]2C(OP)CC(O)C2CC=CCCCC(=O)O)OCCO1 |
| InChI | InChI=1S/C23H41O6P/c1-3-4-9-17(2)23(27-14-15-28-23)13-12-19-18(20(24)16-21(19)29-30)10-7-5-6-8-11-22(25)26/h5,7,17-21,24H,3-4,6,8-16,30H2,1-2H3,(H,25,26)/t17?,18?,19-,20?,21?/m1/s1 |
| InChIKey | ZJTRLYJCEYRUMR-PSTSCRTLSA-N |
| XLogP | 4.71 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|