C24H40O5 — CID 91230175
7-[(2S)-2-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-5-hydroxycyclopent-3-en-1-yl]hept-5-enoic acid (PubChem CID 91230175) has the molecular formula C24H40O5 and a molecular weight of 408.58 g/mol. Its IUPAC name is 7-[(2S)-2-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-5-hydroxycyclopent-3-en-1-yl]hept-5-enoic acid.
| Compound Name | 7-[(2S)-2-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-5-hydroxycyclopent-3-en-1-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 91230175 |
| Molecular Formula | C24H40O5 |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.29 |
| IUPAC Name | 7-[(2S)-2-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-5-hydroxycyclopent-3-en-1-yl]hept-5-enoic acid |
| SMILES | CCCCCCCC1(CC[C@H]2C=CC(O)C2CC=CCCCC(=O)O)OCCO1 |
| InChI | InChI=1S/C24H40O5/c1-2-3-4-7-10-16-24(28-18-19-29-24)17-15-20-13-14-22(25)21(20)11-8-5-6-9-12-23(26)27/h5,8,13-14,20-22,25H,2-4,6-7,9-12,15-19H2,1H3,(H,26,27)/t20-,21?,22?/m1/s1 |
| InChIKey | KQYOBDDSPJGBTL-ITAUSPCMSA-N |
| XLogP | 5.23 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|