C20H32O4 — CID 88845484
7-[(1R,4R,5R,6R)-6-oct-2-enyl-2,3-dioxabicyclo[2.2.1]heptan-5-yl]hept-5-enoic acid (PubChem CID 88845484) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is 7-[(1R,4R,5R,6R)-6-oct-2-enyl-2,3-dioxabicyclo[2.2.1]heptan-5-yl]hept-5-enoic acid.
| Compound Name | 7-[(1R,4R,5R,6R)-6-oct-2-enyl-2,3-dioxabicyclo[2.2.1]heptan-5-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 88845484 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | 7-[(1R,4R,5R,6R)-6-oct-2-enyl-2,3-dioxabicyclo[2.2.1]heptan-5-yl]hept-5-enoic acid |
| SMILES | CCCCCC=CC[C@@H]1[C@@H](CC=CCCCC(=O)O)[C@H]2C[C@H]1OO2 |
| InChI | InChI=1S/C20H32O4/c1-2-3-4-5-6-9-12-16-17(19-15-18(16)23-24-19)13-10-7-8-11-14-20(21)22/h6-7,9-10,16-19H,2-5,8,11-15H2,1H3,(H,21,22)/t16-,17-,18-,19-/m1/s1 |
| InChIKey | OWXYXQVPPSHHJN-NCXUSEDFSA-N |
| XLogP | 5.05 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|