C25H42O5 — CID 90826979
methyl 7-[(2S)-2-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-5-hydroxycyclopent-3-en-1-yl]hept-5-enoate (PubChem CID 90826979) has the molecular formula C25H42O5 and a molecular weight of 422.61 g/mol. Its IUPAC name is methyl 7-[(2S)-2-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-5-hydroxycyclopent-3-en-1-yl]hept-5-enoate.
| Compound Name | methyl 7-[(2S)-2-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-5-hydroxycyclopent-3-en-1-yl]hept-5-enoate |
|---|---|
| PubChem CID | 90826979 |
| Molecular Formula | C25H42O5 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.30 |
| IUPAC Name | methyl 7-[(2S)-2-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-5-hydroxycyclopent-3-en-1-yl]hept-5-enoate |
| SMILES | CCCCCCCC1(CC[C@H]2C=CC(O)C2CC=CCCCC(=O)OC)OCCO1 |
| InChI | InChI=1S/C25H42O5/c1-3-4-5-8-11-17-25(29-19-20-30-25)18-16-21-14-15-23(26)22(21)12-9-6-7-10-13-24(27)28-2/h6,9,14-15,21-23,26H,3-5,7-8,10-13,16-20H2,1-2H3/t21-,22?,23?/m1/s1 |
| InChIKey | KNJXBCKTZASZQG-DDRJZQQSSA-N |
| XLogP | 5.32 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|