C22H41FO5PSi — CID 59963400
CID 59963400 (PubChem CID 59963400) has the molecular formula C22H41FO5PSi and a molecular weight of 463.62 g/mol.
| Compound Name | CID 59963400 |
|---|---|
| PubChem CID | 59963400 |
| Molecular Formula | C22H41FO5PSi |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | — |
| SMILES | CCCCC(F)C(CCC1C(OP)CC(O)C1C/C=C\CCCC(=O)O)O[Si](C)C |
| InChI | InChI=1S/C22H41FO5PSi/c1-4-5-11-18(23)20(28-30(2)3)14-13-17-16(19(24)15-21(17)27-29)10-8-6-7-9-12-22(25)26/h6,8,16-21,24H,4-5,7,9-15,29H2,1-3H3,(H,25,26)/b8-6- |
| InChIKey | XOCDEMHPKHOLGC-VURMDHGXSA-N |
| XLogP | 5.30 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|