C21H39FO2 — CID 59963488
(3S)-3-(4-fluoro-3-hydroxyoctyl)-2-[(Z)-hept-2-enyl]-4-methylcyclopentan-1-ol (PubChem CID 59963488) has the molecular formula C21H39FO2 and a molecular weight of 342.54 g/mol. Its IUPAC name is (3S)-3-(4-fluoro-3-hydroxyoctyl)-2-[(Z)-hept-2-enyl]-4-methylcyclopentan-1-ol.
| Compound Name | (3S)-3-(4-fluoro-3-hydroxyoctyl)-2-[(Z)-hept-2-enyl]-4-methylcyclopentan-1-ol |
|---|---|
| PubChem CID | 59963488 |
| Molecular Formula | C21H39FO2 |
| Molecular Weight | 342.54 g/mol |
| Exact Mass | 342.29 |
| IUPAC Name | (3S)-3-(4-fluoro-3-hydroxyoctyl)-2-[(Z)-hept-2-enyl]-4-methylcyclopentan-1-ol |
| SMILES | CCCC/C=C\CC1C(O)CC(C)[C@@H]1CCC(O)C(F)CCCC |
| InChI | InChI=1S/C21H39FO2/c1-4-6-8-9-10-11-18-17(16(3)15-21(18)24)13-14-20(23)19(22)12-7-5-2/h9-10,16-21,23-24H,4-8,11-15H2,1-3H3/b10-9-/t16?,17-,18?,19?,20?,21?/m0/s1 |
| InChIKey | HABGIUHUJBMRIN-WDYJLVFVSA-N |
| XLogP | 5.43 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.54 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|