C15H27BO3 — CID 58960283
CID 58960283 (PubChem CID 58960283) has the molecular formula C15H27BO3 and a molecular weight of 266.19 g/mol.
| Compound Name | CID 58960283 |
|---|---|
| PubChem CID | 58960283 |
| Molecular Formula | C15H27BO3 |
| Molecular Weight | 266.19 g/mol |
| Exact Mass | 266.21 |
| IUPAC Name | — |
| SMILES | [B]C(O)CC[C@@H]1[C@@H](C/C=C\CCCC)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C15H27BO3/c1-2-3-4-5-6-7-11-12(8-9-15(16)19)14(18)10-13(11)17/h5-6,11-15,17-19H,2-4,7-10H2,1H3/b6-5-/t11-,12-,13+,14-,15?/m1/s1 |
| InChIKey | FWATZXRXCYDYCI-RQYYMEOHSA-N |
| XLogP | 1.75 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.19 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|