C16H30O3 — CID 67572759
cis-(1S,3R)-4-[(Z)-hept-2-enyl]-5-(2-hydroxybutyl)cyclopentane-1,3-diol (PubChem CID 67572759) has the molecular formula C16H30O3 and a molecular weight of 270.41 g/mol. Its IUPAC name is cis-(1S,3R)-4-[(Z)-hept-2-enyl]-5-(2-hydroxybutyl)cyclopentane-1,3-diol.
| Compound Name | cis-(1S,3R)-4-[(Z)-hept-2-enyl]-5-(2-hydroxybutyl)cyclopentane-1,3-diol |
|---|---|
| PubChem CID | 67572759 |
| Molecular Formula | C16H30O3 |
| Molecular Weight | 270.41 g/mol |
| Exact Mass | 270.22 |
| IUPAC Name | cis-(1S,3R)-4-[(Z)-hept-2-enyl]-5-(2-hydroxybutyl)cyclopentane-1,3-diol |
| SMILES | CCCC/C=C\CC1C(CC(O)CC)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C16H30O3/c1-3-5-6-7-8-9-13-14(10-12(17)4-2)16(19)11-15(13)18/h7-8,12-19H,3-6,9-11H2,1-2H3/b8-7-/t12?,13?,14?,15-,16+/m1/s1 |
| InChIKey | BWZOLEPADPHXCY-PSTXBNFCSA-N |
| XLogP | 2.64 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.41 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|