C16H30O4 — CID 70115858
4-(2-hydroxybutyl)-5-(7-hydroxyhept-6-enyl)cyclopentane-1,3-diol (PubChem CID 70115858) has the molecular formula C16H30O4 and a molecular weight of 286.41 g/mol. Its IUPAC name is 4-(2-hydroxybutyl)-5-(7-hydroxyhept-6-enyl)cyclopentane-1,3-diol.
| Compound Name | 4-(2-hydroxybutyl)-5-(7-hydroxyhept-6-enyl)cyclopentane-1,3-diol |
|---|---|
| PubChem CID | 70115858 |
| Molecular Formula | C16H30O4 |
| Molecular Weight | 286.41 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | 4-(2-hydroxybutyl)-5-(7-hydroxyhept-6-enyl)cyclopentane-1,3-diol |
| SMILES | CCC(O)CC1C(O)CC(O)C1CCCCCC=CO |
| InChI | InChI=1S/C16H30O4/c1-2-12(18)10-14-13(15(19)11-16(14)20)8-6-4-3-5-7-9-17/h7,9,12-20H,2-6,8,10-11H2,1H3 |
| InChIKey | KNBAHBWDMQEZSN-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.41 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|