C23H40O4 — CID 67721476
propan-2-yl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E)-oct-3-enyl]cyclopentyl]hept-5-enoate (PubChem CID 67721476) has the molecular formula C23H40O4 and a molecular weight of 380.57 g/mol. Its IUPAC name is propan-2-yl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E)-oct-3-enyl]cyclopentyl]hept-5-enoate.
| Compound Name | propan-2-yl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E)-oct-3-enyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 67721476 |
| Molecular Formula | C23H40O4 |
| Molecular Weight | 380.57 g/mol |
| Exact Mass | 380.29 |
| IUPAC Name | propan-2-yl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E)-oct-3-enyl]cyclopentyl]hept-5-enoate |
| SMILES | CCCC/C=C/CC[C@@H]1[C@@H](C/C=C\CCCC(=O)OC(C)C)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C23H40O4/c1-4-5-6-7-8-11-14-19-20(22(25)17-21(19)24)15-12-9-10-13-16-23(26)27-18(2)3/h7-9,12,18-22,24-25H,4-6,10-11,13-17H2,1-3H3/b8-7+,12-9-/t19-,20-,21-,22+/m1/s1 |
| InChIKey | LGHIDKAFUIXPEM-NAYKONHHSA-N |
| XLogP | 4.94 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.57 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|