C23H42O2 — CID 56632108
propan-2-yl 7-[(1R,2S)-2-octylcyclopentyl]hept-5-enoate (PubChem CID 56632108) has the molecular formula C23H42O2 and a molecular weight of 350.59 g/mol. Its IUPAC name is propan-2-yl 7-[(1R,2S)-2-octylcyclopentyl]hept-5-enoate.
| Compound Name | propan-2-yl 7-[(1R,2S)-2-octylcyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 56632108 |
| Molecular Formula | C23H42O2 |
| Molecular Weight | 350.59 g/mol |
| Exact Mass | 350.32 |
| IUPAC Name | propan-2-yl 7-[(1R,2S)-2-octylcyclopentyl]hept-5-enoate |
| SMILES | CCCCCCCC[C@H]1CCC[C@@H]1CC=CCCCC(=O)OC(C)C |
| InChI | InChI=1S/C23H42O2/c1-4-5-6-7-8-11-15-21-17-14-18-22(21)16-12-9-10-13-19-23(24)25-20(2)3/h9,12,20-22H,4-8,10-11,13-19H2,1-3H3/t21-,22-/m0/s1 |
| InChIKey | FIAANUPAUUVDCE-VXKWHMMOSA-N |
| XLogP | 7.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.59 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|