C26H40O3 — CID 91445561
propan-2-yl 7-[2-(3-hydroxy-5-phenylpentyl)cyclopentyl]hept-5-enoate (PubChem CID 91445561) has the molecular formula C26H40O3 and a molecular weight of 400.60 g/mol. Its IUPAC name is propan-2-yl 7-[2-(3-hydroxy-5-phenylpentyl)cyclopentyl]hept-5-enoate.
| Compound Name | propan-2-yl 7-[2-(3-hydroxy-5-phenylpentyl)cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 91445561 |
| Molecular Formula | C26H40O3 |
| Molecular Weight | 400.60 g/mol |
| Exact Mass | 400.30 |
| IUPAC Name | propan-2-yl 7-[2-(3-hydroxy-5-phenylpentyl)cyclopentyl]hept-5-enoate |
| SMILES | CC(C)OC(=O)CCCC=CCC1CCCC1CCC(O)CCc1ccccc1 |
| InChI | InChI=1S/C26H40O3/c1-21(2)29-26(28)16-9-4-3-8-13-23-14-10-15-24(23)18-20-25(27)19-17-22-11-6-5-7-12-22/h3,5-8,11-12,21,23-25,27H,4,9-10,13-20H2,1-2H3 |
| InChIKey | JBHXMXZXRMVXEM-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.60 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|