C25H40O4 — CID 144918300
ethane;(Z)-7-[(1R,3R)-3-hydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoic acid (PubChem CID 144918300) has the molecular formula C25H40O4 and a molecular weight of 404.59 g/mol. Its IUPAC name is ethane;(Z)-7-[(1R,3R)-3-hydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoic acid.
| Compound Name | ethane;(Z)-7-[(1R,3R)-3-hydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 144918300 |
| Molecular Formula | C25H40O4 |
| Molecular Weight | 404.59 g/mol |
| Exact Mass | 404.29 |
| IUPAC Name | ethane;(Z)-7-[(1R,3R)-3-hydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoic acid |
| SMILES | CC.O=C(O)CCC/C=C\C[C@H]1CC[C@@H](O)C1CC[C@@H](O)CCc1ccccc1 |
| InChI | InChI=1S/C23H34O4.C2H6/c24-20(14-12-18-8-4-3-5-9-18)15-16-21-19(13-17-22(21)25)10-6-1-2-7-11-23(26)27;1-2/h1,3-6,8-9,19-22,24-25H,2,7,10-17H2,(H,26,27);1-2H3/b6-1-;/t19-,20-,21?,22+;/m0./s1 |
| InChIKey | PVTAEBBLYSENQK-KBXZLYERSA-N |
| XLogP | 5.37 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.59 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|