C23H36O3 — CID 91525648
4-[(Z)-hept-2-enyl]-5-(3-hydroxy-5-phenylpentyl)cyclopentane-1,3-diol (PubChem CID 91525648) has the molecular formula C23H36O3 and a molecular weight of 360.54 g/mol. Its IUPAC name is 4-[(Z)-hept-2-enyl]-5-(3-hydroxy-5-phenylpentyl)cyclopentane-1,3-diol.
| Compound Name | 4-[(Z)-hept-2-enyl]-5-(3-hydroxy-5-phenylpentyl)cyclopentane-1,3-diol |
|---|---|
| PubChem CID | 91525648 |
| Molecular Formula | C23H36O3 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | 4-[(Z)-hept-2-enyl]-5-(3-hydroxy-5-phenylpentyl)cyclopentane-1,3-diol |
| SMILES | CCCC/C=C\CC1C(O)CC(O)C1CCC(O)CCc1ccccc1 |
| InChI | InChI=1S/C23H36O3/c1-2-3-4-5-9-12-20-21(23(26)17-22(20)25)16-15-19(24)14-13-18-10-7-6-8-11-18/h5-11,19-26H,2-4,12-17H2,1H3/b9-5- |
| InChIKey | KWTUBBMVEVQJTA-UITAMQMPSA-N |
| XLogP | 4.25 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|