C26H46O5 — CID 123746216
propan-2-yl 7-[5-hydroxy-3-methoxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoate (PubChem CID 123746216) has the molecular formula C26H46O5 and a molecular weight of 438.65 g/mol. Its IUPAC name is propan-2-yl 7-[5-hydroxy-3-methoxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoate.
| Compound Name | propan-2-yl 7-[5-hydroxy-3-methoxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 123746216 |
| Molecular Formula | C26H46O5 |
| Molecular Weight | 438.65 g/mol |
| Exact Mass | 438.33 |
| IUPAC Name | propan-2-yl 7-[5-hydroxy-3-methoxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoate |
| SMILES | CCCCCCCC(=O)CCC1C(OC)CC(O)C1CC=CCCCC(=O)OC(C)C |
| InChI | InChI=1S/C26H46O5/c1-5-6-7-8-11-14-21(27)17-18-23-22(24(28)19-25(23)30-4)15-12-9-10-13-16-26(29)31-20(2)3/h9,12,20,22-25,28H,5-8,10-11,13-19H2,1-4H3 |
| InChIKey | PTDALFQMZGGHSX-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.65 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|