C40H68O14 — CID 159241259
methane;propan-2-yl (Z)-7-[(1R,2R,3R,5S)-3-hydroxy-5-[2-[2-[2-[2-(2-methoxypropanoyloxy)propanoyloxy]propanoyloxy]propanoyloxy]propanoyloxy]-2-octylcyclopentyl]hept-5-enoate (PubChem CID 159241259) has the molecular formula C40H68O14 and a molecular weight of 772.97 g/mol. Its IUPAC name is methane;propan-2-yl (Z)-7-[(1R,2R,3R,5S)-3-hydroxy-5-[2-[2-[2-[2-(2-methoxypropanoyloxy)propanoyloxy]propanoyloxy]propanoyloxy]propanoyloxy]-2-octylcyclopentyl]hept-5-enoate.
| Compound Name | methane;propan-2-yl (Z)-7-[(1R,2R,3R,5S)-3-hydroxy-5-[2-[2-[2-[2-(2-methoxypropanoyloxy)propanoyloxy]propanoyloxy]propanoyloxy]propanoyloxy]-2-octylcyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 159241259 |
| Molecular Formula | C40H68O14 |
| Molecular Weight | 772.97 g/mol |
| Exact Mass | 772.46 |
| IUPAC Name | methane;propan-2-yl (Z)-7-[(1R,2R,3R,5S)-3-hydroxy-5-[2-[2-[2-[2-(2-methoxypropanoyloxy)propanoyloxy]propanoyloxy]propanoyloxy]propanoyloxy]-2-octylcyclopentyl]hept-5-enoate |
| SMILES | C.CCCCCCCC[C@@H]1[C@@H](C/C=C\CCCC(=O)OC(C)C)[C@@H](OC(=O)C(C)OC(=O)C(C)OC(=O)C(C)OC(=O)C(C)OC(=O)C(C)OC)C[C@H]1O |
| InChI | InChI=1S/C39H64O14.CH4/c1-10-11-12-13-14-17-20-30-31(21-18-15-16-19-22-34(41)48-24(2)3)33(23-32(30)40)53-39(46)29(8)52-38(45)28(7)51-37(44)27(6)50-36(43)26(5)49-35(42)25(4)47-9;/h15,18,24-33,40H,10-14,16-17,19-23H2,1-9H3;1H4/b18-15-;/t25?,26?,27?,28?,29?,30-,31-,32-,33+;/m1./s1 |
| InChIKey | KUCXSVAYWOHOFP-NTSFQURISA-N |
| XLogP | 6.11 |
| TPSA | 187.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.97 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|