C21H36O4S — CID 90794857
methyl 7-[(2R,3R,5S)-5-hydroxy-2-(3-oxooctyl)-3-sulfanylcyclopentyl]hept-5-enoate (PubChem CID 90794857) has the molecular formula C21H36O4S and a molecular weight of 384.58 g/mol. Its IUPAC name is methyl 7-[(2R,3R,5S)-5-hydroxy-2-(3-oxooctyl)-3-sulfanylcyclopentyl]hept-5-enoate.
| Compound Name | methyl 7-[(2R,3R,5S)-5-hydroxy-2-(3-oxooctyl)-3-sulfanylcyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 90794857 |
| Molecular Formula | C21H36O4S |
| Molecular Weight | 384.58 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | methyl 7-[(2R,3R,5S)-5-hydroxy-2-(3-oxooctyl)-3-sulfanylcyclopentyl]hept-5-enoate |
| SMILES | CCCCCC(=O)CC[C@@H]1C(CC=CCCCC(=O)OC)[C@@H](O)C[C@H]1S |
| InChI | InChI=1S/C21H36O4S/c1-3-4-7-10-16(22)13-14-18-17(19(23)15-20(18)26)11-8-5-6-9-12-21(24)25-2/h5,8,17-20,23,26H,3-4,6-7,9-15H2,1-2H3/t17?,18-,19+,20-/m1/s1 |
| InChIKey | HRYIGPMAPMGPCX-RAFMOHDBSA-N |
| XLogP | 4.50 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.58 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|