C26H45NO9 — CID 11318276
2-(2-nitrooxyethoxy)ethyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoate (PubChem CID 11318276) has the molecular formula C26H45NO9 and a molecular weight of 515.64 g/mol. Its IUPAC name is 2-(2-nitrooxyethoxy)ethyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoate.
| Compound Name | 2-(2-nitrooxyethoxy)ethyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 11318276 |
| Molecular Formula | C26H45NO9 |
| Molecular Weight | 515.64 g/mol |
| Exact Mass | 515.31 |
| IUPAC Name | 2-(2-nitrooxyethoxy)ethyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoate |
| SMILES | CCCCCCCC(=O)CC[C@@H]1[C@@H](C/C=C\CCCC(=O)OCCOCCO[N+](=O)[O-])[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C26H45NO9/c1-2-3-4-5-8-11-21(28)14-15-23-22(24(29)20-25(23)30)12-9-6-7-10-13-26(31)35-18-16-34-17-19-36-27(32)33/h6,9,22-25,29-30H,2-5,7-8,10-20H2,1H3/b9-6-/t22-,23-,24+,25-/m1/s1 |
| InChIKey | WDDUEAGPPCRLEV-JFSBGGPPSA-N |
| XLogP | 3.94 |
| TPSA | 145.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.64 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|