C27H46N2O9 — CID 91283668
2-nitrooxypropyl 2-[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoylamino]acetate (PubChem CID 91283668) has the molecular formula C27H46N2O9 and a molecular weight of 542.67 g/mol. Its IUPAC name is 2-nitrooxypropyl 2-[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoylamino]acetate.
| Compound Name | 2-nitrooxypropyl 2-[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoylamino]acetate |
|---|---|
| PubChem CID | 91283668 |
| Molecular Formula | C27H46N2O9 |
| Molecular Weight | 542.67 g/mol |
| Exact Mass | 542.32 |
| IUPAC Name | 2-nitrooxypropyl 2-[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoylamino]acetate |
| SMILES | CCCCCCCC(=O)CC[C@@H]1[C@@H](CC=CCCCC(=O)NCC(=O)OCC(C)O[N+](=O)[O-])[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C27H46N2O9/c1-3-4-5-6-9-12-21(30)15-16-23-22(24(31)17-25(23)32)13-10-7-8-11-14-26(33)28-18-27(34)37-19-20(2)38-29(35)36/h7,10,20,22-25,31-32H,3-6,8-9,11-19H2,1-2H3,(H,28,33)/t20?,22-,23-,24+,25-/m1/s1 |
| InChIKey | RWZNCRCAWDTBOY-BKOMXBJOSA-N |
| XLogP | 3.43 |
| TPSA | 165.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.67 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|