C32H48N2O9 — CID 90686322
[2-(nitrooxymethyl)phenyl] 2-[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoylamino]propanoate (PubChem CID 90686322) has the molecular formula C32H48N2O9 and a molecular weight of 604.74 g/mol. Its IUPAC name is [2-(nitrooxymethyl)phenyl] 2-[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoylamino]propanoate.
| Compound Name | [2-(nitrooxymethyl)phenyl] 2-[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoylamino]propanoate |
|---|---|
| PubChem CID | 90686322 |
| Molecular Formula | C32H48N2O9 |
| Molecular Weight | 604.74 g/mol |
| Exact Mass | 604.34 |
| IUPAC Name | [2-(nitrooxymethyl)phenyl] 2-[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoylamino]propanoate |
| SMILES | CCCCCCCC(=O)CC[C@@H]1[C@@H](CC=CCCCC(=O)NC(C)C(=O)Oc2ccccc2CO[N+](=O)[O-])[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C32H48N2O9/c1-3-4-5-6-9-15-25(35)19-20-27-26(28(36)21-29(27)37)16-10-7-8-11-18-31(38)33-23(2)32(39)43-30-17-13-12-14-24(30)22-42-34(40)41/h7,10,12-14,17,23,26-29,36-37H,3-6,8-9,11,15-16,18-22H2,1-2H3,(H,33,38)/t23?,26-,27-,28+,29-/m1/s1 |
| InChIKey | CPBUTRUJICSXLJ-HFJVTLJMSA-N |
| XLogP | 4.99 |
| TPSA | 165.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.74 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|