C42H57NO9 — CID 89068921
[2-methoxy-4-[(E)-3-(3-methylphenoxy)-3-oxoprop-1-enyl]phenyl] 2-[[(Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoyl]amino]propanoate (PubChem CID 89068921) has the molecular formula C42H57NO9 and a molecular weight of 719.92 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-3-(3-methylphenoxy)-3-oxoprop-1-enyl]phenyl] 2-[[(Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoyl]amino]propanoate.
| Compound Name | [2-methoxy-4-[(E)-3-(3-methylphenoxy)-3-oxoprop-1-enyl]phenyl] 2-[[(Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoyl]amino]propanoate |
|---|---|
| PubChem CID | 89068921 |
| Molecular Formula | C42H57NO9 |
| Molecular Weight | 719.92 g/mol |
| Exact Mass | 719.40 |
| IUPAC Name | [2-methoxy-4-[(E)-3-(3-methylphenoxy)-3-oxoprop-1-enyl]phenyl] 2-[[(Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoyl]amino]propanoate |
| SMILES | CCCCCCCC(=O)CC[C@@H]1[C@@H](C/C=C\CCCC(=O)NC(C)C(=O)Oc2ccc(/C=C/C(=O)Oc3cccc(C)c3)cc2OC)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C42H57NO9/c1-5-6-7-8-11-16-32(44)22-23-35-34(36(45)28-37(35)46)18-12-9-10-13-19-40(47)43-30(3)42(49)52-38-24-20-31(27-39(38)50-4)21-25-41(48)51-33-17-14-15-29(2)26-33/h9,12,14-15,17,20-21,24-27,30,34-37,45-46H,5-8,10-11,13,16,18-19,22-23,28H2,1-4H3,(H,43,47)/b12-9-,25-21+/t30?,34-,35-,36+,37-/m1/s1 |
| InChIKey | ZUKMFWGPBFUOFQ-GOVWYPQUSA-N |
| XLogP | 7.22 |
| TPSA | 148.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.92 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|