C36H53NO11 — CID 11342872
[2-methoxy-4-[(E)-3-(4-nitrooxybutoxy)-3-oxoprop-1-enyl]phenyl] (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoate (PubChem CID 11342872) has the molecular formula C36H53NO11 and a molecular weight of 675.82 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-3-(4-nitrooxybutoxy)-3-oxoprop-1-enyl]phenyl] (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoate.
| Compound Name | [2-methoxy-4-[(E)-3-(4-nitrooxybutoxy)-3-oxoprop-1-enyl]phenyl] (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 11342872 |
| Molecular Formula | C36H53NO11 |
| Molecular Weight | 675.82 g/mol |
| Exact Mass | 675.36 |
| IUPAC Name | [2-methoxy-4-[(E)-3-(4-nitrooxybutoxy)-3-oxoprop-1-enyl]phenyl] (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoate |
| SMILES | CCCCCCCC(=O)CC[C@@H]1[C@@H](C/C=C\CCCC(=O)Oc2ccc(/C=C/C(=O)OCCCCO[N+](=O)[O-])cc2OC)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C36H53NO11/c1-3-4-5-6-9-14-28(38)19-20-30-29(31(39)26-32(30)40)15-10-7-8-11-16-36(42)48-33-21-17-27(25-34(33)45-2)18-22-35(41)46-23-12-13-24-47-37(43)44/h7,10,17-18,21-22,25,29-32,39-40H,3-6,8-9,11-16,19-20,23-24,26H2,1-2H3/b10-7-,22-18+/t29-,30-,31+,32-/m1/s1 |
| InChIKey | ZICOMYSLDAVBJO-CIVYBKOJSA-N |
| XLogP | 6.33 |
| TPSA | 171.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.82 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|